C14H19KO7S — CID 173139453
potassium;4-(2,3-dimethylbutan-2-yloxycarbonyl)-3-sulfobenzoic acid;hydride (PubChem CID 173139453) has the molecular formula C14H19KO7S and a molecular weight of 370.46 g/mol. Its IUPAC name is potassium;4-(2,3-dimethylbutan-2-yloxycarbonyl)-3-sulfobenzoic acid;hydride.
| Compound Name | potassium;4-(2,3-dimethylbutan-2-yloxycarbonyl)-3-sulfobenzoic acid;hydride |
|---|---|
| PubChem CID | 173139453 |
| Molecular Formula | C14H19KO7S |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | potassium;4-(2,3-dimethylbutan-2-yloxycarbonyl)-3-sulfobenzoic acid;hydride |
| SMILES | CC(C)C(C)(C)OC(=O)c1ccc(C(=O)O)cc1S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C14H18O7S.K.H/c1-8(2)14(3,4)21-13(17)10-6-5-9(12(15)16)7-11(10)22(18,19)20;;/h5-8H,1-4H3,(H,15,16)(H,18,19,20);;/q;+1;-1 |
| InChIKey | SPZJWRYOEJZUHO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|