C7H7KO6S — CID 173217056
potassium;hydride;3-hydroxy-4-sulfobenzoic acid (PubChem CID 173217056) has the molecular formula C7H7KO6S and a molecular weight of 258.29 g/mol. Its IUPAC name is potassium;hydride;3-hydroxy-4-sulfobenzoic acid.
| Compound Name | potassium;hydride;3-hydroxy-4-sulfobenzoic acid |
|---|---|
| PubChem CID | 173217056 |
| Molecular Formula | C7H7KO6S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | potassium;hydride;3-hydroxy-4-sulfobenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)c(O)c1.[H-].[K+] |
| InChI | InChI=1S/C7H6O6S.K.H/c8-5-3-4(7(9)10)1-2-6(5)14(11,12)13;;/h1-3,8H,(H,9,10)(H,11,12,13);;/q;+1;-1 |
| InChIKey | SELYTMGNRONXTG-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|