C14H12O8Zr — CID 23558402
bis(3,4-dihydroxybenzoic acid);zirconium (PubChem CID 23558402) has the molecular formula C14H12O8Zr and a molecular weight of 399.47 g/mol. Its IUPAC name is bis(3,4-dihydroxybenzoic acid);zirconium.
| Compound Name | bis(3,4-dihydroxybenzoic acid);zirconium |
|---|---|
| PubChem CID | 23558402 |
| Molecular Formula | C14H12O8Zr |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | bis(3,4-dihydroxybenzoic acid);zirconium |
| SMILES | O=C(O)c1ccc(O)c(O)c1.O=C(O)c1ccc(O)c(O)c1.[Zr] |
| InChI | InChI=1S/2C7H6O4.Zr/c2*8-5-2-1-4(7(10)11)3-6(5)9;/h2*1-3,8-9H,(H,10,11); |
| InChIKey | FJEFGOXUSDMZIK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|