C19H17NO7 — CID 69010331
4-(4-aminophenoxy)benzene-1,2-diol;3,4-dihydroxybenzoic acid (PubChem CID 69010331) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-(4-aminophenoxy)benzene-1,2-diol;3,4-dihydroxybenzoic acid.
| Compound Name | 4-(4-aminophenoxy)benzene-1,2-diol;3,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 69010331 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-(4-aminophenoxy)benzene-1,2-diol;3,4-dihydroxybenzoic acid |
| SMILES | Nc1ccc(Oc2ccc(O)c(O)c2)cc1.O=C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H11NO3.C7H6O4/c13-8-1-3-9(4-2-8)16-10-5-6-11(14)12(15)7-10;8-5-2-1-4(7(10)11)3-6(5)9/h1-7,14-15H,13H2;1-3,8-9H,(H,10,11) |
| InChIKey | BNTWJJBHTZWSHO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|