C20H16N2O6 — CID 139816364
3-amino-5-[4-(3-amino-5-carboxyphenoxy)phenoxy]benzoic acid (PubChem CID 139816364) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-amino-5-[4-(3-amino-5-carboxyphenoxy)phenoxy]benzoic acid.
| Compound Name | 3-amino-5-[4-(3-amino-5-carboxyphenoxy)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 139816364 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-amino-5-[4-(3-amino-5-carboxyphenoxy)phenoxy]benzoic acid |
| SMILES | Nc1cc(Oc2ccc(Oc3cc(N)cc(C(=O)O)c3)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C20H16N2O6/c21-13-5-11(19(23)24)7-17(9-13)27-15-1-2-16(4-3-15)28-18-8-12(20(25)26)6-14(22)10-18/h1-10H,21-22H2,(H,23,24)(H,25,26) |
| InChIKey | FZYCKGJCFZLVSK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|