C14H15N3O4 — CID 142851105
5-aminobenzene-1,3-dicarboxylic acid;benzene-1,4-diamine (PubChem CID 142851105) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-aminobenzene-1,3-dicarboxylic acid;benzene-1,4-diamine.
| Compound Name | 5-aminobenzene-1,3-dicarboxylic acid;benzene-1,4-diamine |
|---|---|
| PubChem CID | 142851105 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-aminobenzene-1,3-dicarboxylic acid;benzene-1,4-diamine |
| SMILES | Nc1cc(C(=O)O)cc(C(=O)O)c1.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C8H7NO4.C6H8N2/c9-6-2-4(7(10)11)1-5(3-6)8(12)13;7-5-1-2-6(8)4-3-5/h1-3H,9H2,(H,10,11)(H,12,13);1-4H,7-8H2 |
| InChIKey | RFIBEHVWVLNUOK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|