C24H16O8Zr — CID 162353964
bis(naphthalene-2,6-dicarboxylic acid);zirconium (PubChem CID 162353964) has the molecular formula C24H16O8Zr and a molecular weight of 523.61 g/mol. Its IUPAC name is bis(naphthalene-2,6-dicarboxylic acid);zirconium.
| Compound Name | bis(naphthalene-2,6-dicarboxylic acid);zirconium |
|---|---|
| PubChem CID | 162353964 |
| Molecular Formula | C24H16O8Zr |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | bis(naphthalene-2,6-dicarboxylic acid);zirconium |
| SMILES | O=C(O)c1ccc2cc(C(=O)O)ccc2c1.O=C(O)c1ccc2cc(C(=O)O)ccc2c1.[Zr] |
| InChI | InChI=1S/2C12H8O4.Zr/c2*13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9;/h2*1-6H,(H,13,14)(H,15,16); |
| InChIKey | XNWUKGIEIQTULP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |