About actinium;6-hydroxynaphthalene-2-carboxylic acid
actinium;6-hydroxynaphthalene-2-carboxylic acid (PubChem CID 59891781) has the molecular formula C11H8AcO3
and a molecular weight of 415.18 g/mol. Its IUPAC name is actinium;6-hydroxynaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | actinium;6-hydroxynaphthalene-2-carboxylic acid |
| PubChem CID | 59891781 |
| Molecular Formula | C11H8AcO3 |
| Molecular Weight | 415.18 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | actinium;6-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(O)ccc2c1.[Ac] |
| InChI | InChI=1S/C11H8O3.Ac/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10;/h1-6,12H,(H,13,14); |
| InChIKey | DTZSBMGGDBKCMD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze actinium;6-hydroxynaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;6-hydroxynaphthalene-2-carboxylic acid?
The IUPAC name of actinium;6-hydroxynaphthalene-2-carboxylic acid (CID 59891781) is actinium;6-hydroxynaphthalene-2-carboxylic acid.
What is the SMILES notation for actinium;6-hydroxynaphthalene-2-carboxylic acid?
The canonical SMILES for actinium;6-hydroxynaphthalene-2-carboxylic acid is O=C(O)c1ccc2cc(O)ccc2c1.[Ac].
What is the InChIKey of actinium;6-hydroxynaphthalene-2-carboxylic acid?
The InChIKey is DTZSBMGGDBKCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3.Ac/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10;/h1-6,12H,(H,13,14);.
What are the key properties of actinium;6-hydroxynaphthalene-2-carboxylic acid?
actinium;6-hydroxynaphthalene-2-carboxylic acid has a molecular weight of 415.18 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;6-hydroxynaphthalene-2-carboxylic acid is sourced from PubChem (CID 59891781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).