About naphthalene-2-carboxylic acid;naphthalen-2-ol
naphthalene-2-carboxylic acid;naphthalen-2-ol (PubChem CID 161405760) has the molecular formula C21H16O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is naphthalene-2-carboxylic acid;naphthalen-2-ol.
Molecular Properties
| Compound Name | naphthalene-2-carboxylic acid;naphthalen-2-ol |
| PubChem CID | 161405760 |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | naphthalene-2-carboxylic acid;naphthalen-2-ol |
| SMILES | O=C(O)c1ccc2ccccc2c1.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O2.C10H8O/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,12,13);1-7,11H |
| InChIKey | VUUVGCHDQMTPJF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalene-2-carboxylic acid;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-carboxylic acid;naphthalen-2-ol?
The IUPAC name of naphthalene-2-carboxylic acid;naphthalen-2-ol (CID 161405760) is naphthalene-2-carboxylic acid;naphthalen-2-ol.
What is the SMILES notation for naphthalene-2-carboxylic acid;naphthalen-2-ol?
The canonical SMILES for naphthalene-2-carboxylic acid;naphthalen-2-ol is O=C(O)c1ccc2ccccc2c1.Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalene-2-carboxylic acid;naphthalen-2-ol?
The InChIKey is VUUVGCHDQMTPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.C10H8O/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,12,13);1-7,11H.
What are the key properties of naphthalene-2-carboxylic acid;naphthalen-2-ol?
naphthalene-2-carboxylic acid;naphthalen-2-ol has a molecular weight of 316.36 g/mol, XLogP of 5.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-carboxylic acid;naphthalen-2-ol is sourced from PubChem (CID 161405760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).