About naphthalene-2-carboxylic acid;dihydrochloride
naphthalene-2-carboxylic acid;dihydrochloride (PubChem CID 70357946) has the molecular formula C11H10Cl2O2
and a molecular weight of 245.11 g/mol. Its IUPAC name is naphthalene-2-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | naphthalene-2-carboxylic acid;dihydrochloride |
| PubChem CID | 70357946 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | naphthalene-2-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O2.2ClH/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;;/h1-7H,(H,12,13);2*1H |
| InChIKey | LPWXNRMFRZHTJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphthalene-2-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-carboxylic acid;dihydrochloride?
The IUPAC name of naphthalene-2-carboxylic acid;dihydrochloride (CID 70357946) is naphthalene-2-carboxylic acid;dihydrochloride.
What is the SMILES notation for naphthalene-2-carboxylic acid;dihydrochloride?
The canonical SMILES for naphthalene-2-carboxylic acid;dihydrochloride is Cl.Cl.O=C(O)c1ccc2ccccc2c1.
What is the InChIKey of naphthalene-2-carboxylic acid;dihydrochloride?
The InChIKey is LPWXNRMFRZHTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.2ClH/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;;/h1-7H,(H,12,13);2*1H.
What are the key properties of naphthalene-2-carboxylic acid;dihydrochloride?
naphthalene-2-carboxylic acid;dihydrochloride has a molecular weight of 245.11 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-carboxylic acid;dihydrochloride is sourced from PubChem (CID 70357946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).