About ethane;naphthalene-2-carboxylic acid;propane
ethane;naphthalene-2-carboxylic acid;propane (PubChem CID 143443534) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is ethane;naphthalene-2-carboxylic acid;propane.
Molecular Properties
| Compound Name | ethane;naphthalene-2-carboxylic acid;propane |
| PubChem CID | 143443534 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethane;naphthalene-2-carboxylic acid;propane |
| SMILES | CC.CCC.O=C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O2.C3H8.C2H6/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;1-3-2;1-2/h1-7H,(H,12,13);3H2,1-2H3;1-2H3 |
| InChIKey | ZETBMPVGJIQLAN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;naphthalene-2-carboxylic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;naphthalene-2-carboxylic acid;propane?
The IUPAC name of ethane;naphthalene-2-carboxylic acid;propane (CID 143443534) is ethane;naphthalene-2-carboxylic acid;propane.
What is the SMILES notation for ethane;naphthalene-2-carboxylic acid;propane?
The canonical SMILES for ethane;naphthalene-2-carboxylic acid;propane is CC.CCC.O=C(O)c1ccc2ccccc2c1.
What is the InChIKey of ethane;naphthalene-2-carboxylic acid;propane?
The InChIKey is ZETBMPVGJIQLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.C3H8.C2H6/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;1-3-2;1-2/h1-7H,(H,12,13);3H2,1-2H3;1-2H3.
What are the key properties of ethane;naphthalene-2-carboxylic acid;propane?
ethane;naphthalene-2-carboxylic acid;propane has a molecular weight of 246.35 g/mol, XLogP of 4.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;naphthalene-2-carboxylic acid;propane is sourced from PubChem (CID 143443534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).