About CID 67200510
CID 67200510 (PubChem CID 67200510) has the molecular formula C12H8MgO4
and a molecular weight of 240.50 g/mol.
Molecular Properties
| Compound Name | CID 67200510 |
| PubChem CID | 67200510 |
| Molecular Formula | C12H8MgO4 |
| Molecular Weight | 240.50 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc2cc(C(=O)O)ccc2c1.[Mg] |
| InChI | InChI=1S/C12H8O4.Mg/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9;/h1-6H,(H,13,14)(H,15,16); |
| InChIKey | UDDYDPYPRKLYEK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 67200510 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67200510?
The IUPAC name of CID 67200510 (CID 67200510) is not available.
What is the SMILES notation for CID 67200510?
The canonical SMILES for CID 67200510 is O=C(O)c1ccc2cc(C(=O)O)ccc2c1.[Mg].
What is the InChIKey of CID 67200510?
The InChIKey is UDDYDPYPRKLYEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4.Mg/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9;/h1-6H,(H,13,14)(H,15,16);.
What are the key properties of CID 67200510?
CID 67200510 has a molecular weight of 240.50 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67200510 is sourced from PubChem (CID 67200510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).