C10H8O — CID 71750931
naphthalen-2-ol (PubChem CID 71750931) has the molecular formula C10H8O and a molecular weight of 154.10 g/mol. Its IUPAC name is naphthalen-2-ol.
| Compound Name | naphthalen-2-ol |
|---|---|
| PubChem CID | 71750931 |
| Molecular Formula | C10H8O |
| Molecular Weight | 154.10 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | naphthalen-2-ol |
| SMILES | O[13c]1[13cH][13cH][13c]2[13cH][13cH][13cH][13cH][13c]2[13cH]1 |
| InChI | InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 |
| InChIKey | JWAZRIHNYRIHIV-IIYFYTTLSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.10 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |