About ethane;naphthalen-2-ol
ethane;naphthalen-2-ol (PubChem CID 91107047) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is ethane;naphthalen-2-ol.
Molecular Properties
| Compound Name | ethane;naphthalen-2-ol |
| PubChem CID | 91107047 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | ethane;naphthalen-2-ol |
| SMILES | CC.CC.CC.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.3C2H6/c11-10-6-5-8-3-1-2-4-9(8)7-10;3*1-2/h1-7,11H;3*1-2H3 |
| InChIKey | HKZXKRNHEYJDBC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;naphthalen-2-ol?
The IUPAC name of ethane;naphthalen-2-ol (CID 91107047) is ethane;naphthalen-2-ol.
What is the SMILES notation for ethane;naphthalen-2-ol?
The canonical SMILES for ethane;naphthalen-2-ol is CC.CC.CC.Oc1ccc2ccccc2c1.
What is the InChIKey of ethane;naphthalen-2-ol?
The InChIKey is HKZXKRNHEYJDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.3C2H6/c11-10-6-5-8-3-1-2-4-9(8)7-10;3*1-2/h1-7,11H;3*1-2H3.
What are the key properties of ethane;naphthalen-2-ol?
ethane;naphthalen-2-ol has a molecular weight of 234.38 g/mol, XLogP of 5.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;naphthalen-2-ol is sourced from PubChem (CID 91107047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).