About cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol
cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol (PubChem CID 156699772) has the molecular formula C15H13Cl2OTi-
and a molecular weight of 328.04 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol |
| PubChem CID | 156699772 |
| Molecular Formula | C15H13Cl2OTi- |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol |
| SMILES | Cl[Ti]Cl.Oc1ccc2ccccc2c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C10H8O.C5H5.2ClH.Ti/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-4-5-3-1;;;/h1-7,11H;1-5H;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | DUEVWLIZQASCDD-UHFFFAOYSA-L |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol?
The IUPAC name of cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol (CID 156699772) is cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol.
What is the SMILES notation for cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol?
The canonical SMILES for cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol is Cl[Ti]Cl.Oc1ccc2ccccc2c1.c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol?
The InChIKey is DUEVWLIZQASCDD-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O.C5H5.2ClH.Ti/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-4-5-3-1;;;/h1-7,11H;1-5H;2*1H;/q;-1;;;+2/p-2.
What are the key properties of cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol?
cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol has a molecular weight of 328.04 g/mol, XLogP of 5.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;dichlorotitanium;naphthalen-2-ol is sourced from PubChem (CID 156699772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).