About naphthalen-2-ol;phenylmethoxymethylbenzene
naphthalen-2-ol;phenylmethoxymethylbenzene (PubChem CID 18786875) has the molecular formula C24H22O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is naphthalen-2-ol;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | naphthalen-2-ol;phenylmethoxymethylbenzene |
| PubChem CID | 18786875 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | naphthalen-2-ol;phenylmethoxymethylbenzene |
| SMILES | Oc1ccc2ccccc2c1.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C10H8O/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-10H,11-12H2;1-7,11H |
| InChIKey | FCFZZNZEZPBXLA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalen-2-ol;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ol;phenylmethoxymethylbenzene?
The IUPAC name of naphthalen-2-ol;phenylmethoxymethylbenzene (CID 18786875) is naphthalen-2-ol;phenylmethoxymethylbenzene.
What is the SMILES notation for naphthalen-2-ol;phenylmethoxymethylbenzene?
The canonical SMILES for naphthalen-2-ol;phenylmethoxymethylbenzene is Oc1ccc2ccccc2c1.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of naphthalen-2-ol;phenylmethoxymethylbenzene?
The InChIKey is FCFZZNZEZPBXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C10H8O/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-10H,11-12H2;1-7,11H.
What are the key properties of naphthalen-2-ol;phenylmethoxymethylbenzene?
naphthalen-2-ol;phenylmethoxymethylbenzene has a molecular weight of 342.44 g/mol, XLogP of 5.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ol;phenylmethoxymethylbenzene is sourced from PubChem (CID 18786875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).