About dichloromethane;phenylmethoxymethylbenzene
dichloromethane;phenylmethoxymethylbenzene (PubChem CID 174530379) has the molecular formula C15H16Cl2O
and a molecular weight of 283.20 g/mol. Its IUPAC name is dichloromethane;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | dichloromethane;phenylmethoxymethylbenzene |
| PubChem CID | 174530379 |
| Molecular Formula | C15H16Cl2O |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | dichloromethane;phenylmethoxymethylbenzene |
| SMILES | ClCCl.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.CH2Cl2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;2-1-3/h1-10H,11-12H2;1H2 |
| InChIKey | MIZFQCSUZCMQEB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;phenylmethoxymethylbenzene?
The IUPAC name of dichloromethane;phenylmethoxymethylbenzene (CID 174530379) is dichloromethane;phenylmethoxymethylbenzene.
What is the SMILES notation for dichloromethane;phenylmethoxymethylbenzene?
The canonical SMILES for dichloromethane;phenylmethoxymethylbenzene is ClCCl.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of dichloromethane;phenylmethoxymethylbenzene?
The InChIKey is MIZFQCSUZCMQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.CH2Cl2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;2-1-3/h1-10H,11-12H2;1H2.
What are the key properties of dichloromethane;phenylmethoxymethylbenzene?
dichloromethane;phenylmethoxymethylbenzene has a molecular weight of 283.20 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;phenylmethoxymethylbenzene is sourced from PubChem (CID 174530379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).