About dimethyltin;phenylmethoxymethylbenzene
dimethyltin;phenylmethoxymethylbenzene (PubChem CID 87392963) has the molecular formula C16H20OSn
and a molecular weight of 347.05 g/mol. Its IUPAC name is dimethyltin;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | dimethyltin;phenylmethoxymethylbenzene |
| PubChem CID | 87392963 |
| Molecular Formula | C16H20OSn |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | dimethyltin;phenylmethoxymethylbenzene |
| SMILES | C[Sn]C.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.2CH3.Sn/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;/h1-10H,11-12H2;2*1H3; |
| InChIKey | CDZOBVOPTHSFOD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dimethyltin;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin;phenylmethoxymethylbenzene?
The IUPAC name of dimethyltin;phenylmethoxymethylbenzene (CID 87392963) is dimethyltin;phenylmethoxymethylbenzene.
What is the SMILES notation for dimethyltin;phenylmethoxymethylbenzene?
The canonical SMILES for dimethyltin;phenylmethoxymethylbenzene is C[Sn]C.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of dimethyltin;phenylmethoxymethylbenzene?
The InChIKey is CDZOBVOPTHSFOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.2CH3.Sn/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;/h1-10H,11-12H2;2*1H3;.
What are the key properties of dimethyltin;phenylmethoxymethylbenzene?
dimethyltin;phenylmethoxymethylbenzene has a molecular weight of 347.05 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin;phenylmethoxymethylbenzene is sourced from PubChem (CID 87392963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).