phenylmethoxymethylbenzene;phosphoric acid

C14H17O5P — CID 141118417

IUPACphenylmethoxymethylbenzene;phosphoric acid
SMILESO=P(O)(O)O.c1ccc(COCc2ccccc2)cc1
InChIInChI=1S/C14H14O.H3O4P/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-5(2,3)4/h1-10H,11-12H2;(H3,1,2,3,4)
InChIKeySXWHCIOOMQMTAV-UHFFFAOYSA-N
MW296.26 g/mol
LogP2.47
Rot. Bonds4

About phenylmethoxymethylbenzene;phosphoric acid

phenylmethoxymethylbenzene;phosphoric acid (PubChem CID 141118417) has the molecular formula C14H17O5P and a molecular weight of 296.26 g/mol. Its IUPAC name is phenylmethoxymethylbenzene;phosphoric acid.

Molecular Properties

Compound Namephenylmethoxymethylbenzene;phosphoric acid
PubChem CID141118417
Molecular FormulaC14H17O5P
Molecular Weight296.26 g/mol
Exact Mass296.08
IUPAC Namephenylmethoxymethylbenzene;phosphoric acid
SMILESO=P(O)(O)O.c1ccc(COCc2ccccc2)cc1
InChIInChI=1S/C14H14O.H3O4P/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-5(2,3)4/h1-10H,11-12H2;(H3,1,2,3,4)
InChIKeySXWHCIOOMQMTAV-UHFFFAOYSA-N
XLogP2.47
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.26
LogP ≤ 52.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze phenylmethoxymethylbenzene;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenylmethoxymethylbenzene;phosphoric acid?
The IUPAC name of phenylmethoxymethylbenzene;phosphoric acid (CID 141118417) is phenylmethoxymethylbenzene;phosphoric acid.
What is the SMILES notation for phenylmethoxymethylbenzene;phosphoric acid?
The canonical SMILES for phenylmethoxymethylbenzene;phosphoric acid is O=P(O)(O)O.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of phenylmethoxymethylbenzene;phosphoric acid?
The InChIKey is SXWHCIOOMQMTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.H3O4P/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-5(2,3)4/h1-10H,11-12H2;(H3,1,2,3,4).
What are the key properties of phenylmethoxymethylbenzene;phosphoric acid?
phenylmethoxymethylbenzene;phosphoric acid has a molecular weight of 296.26 g/mol, XLogP of 2.47, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxymethylbenzene;phosphoric acid is sourced from PubChem (CID 141118417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).