C7H10O6P2 — CID 87473581
[hydroxy(phenylmethoxy)phosphoryl]phosphonic acid (PubChem CID 87473581) has the molecular formula C7H10O6P2 and a molecular weight of 252.10 g/mol. Its IUPAC name is [hydroxy(phenylmethoxy)phosphoryl]phosphonic acid.
| Compound Name | [hydroxy(phenylmethoxy)phosphoryl]phosphonic acid |
|---|---|
| PubChem CID | 87473581 |
| Molecular Formula | C7H10O6P2 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | [hydroxy(phenylmethoxy)phosphoryl]phosphonic acid |
| SMILES | O=P(O)(O)P(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C7H10O6P2/c8-14(9,10)15(11,12)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)(H2,8,9,10) |
| InChIKey | YTYMBFFNKFRAHY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|