C11H17O4P — CID 140989025
benzyl tert-butyl hydrogen phosphate (PubChem CID 140989025) has the molecular formula C11H17O4P and a molecular weight of 244.23 g/mol. Its IUPAC name is benzyl tert-butyl hydrogen phosphate.
| Compound Name | benzyl tert-butyl hydrogen phosphate |
|---|---|
| PubChem CID | 140989025 |
| Molecular Formula | C11H17O4P |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | benzyl tert-butyl hydrogen phosphate |
| SMILES | CC(C)(C)OP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C11H17O4P/c1-11(2,3)15-16(12,13)14-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,12,13) |
| InChIKey | ASBLACUUHPSMSN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|