C18H29O7P — CID 168835403
bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-phenylmethoxyacetate (PubChem CID 168835403) has the molecular formula C18H29O7P and a molecular weight of 388.40 g/mol. Its IUPAC name is bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-phenylmethoxyacetate.
| Compound Name | bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 168835403 |
| Molecular Formula | C18H29O7P |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl 2-phenylmethoxyacetate |
| SMILES | CC(C)(C)OP(=O)(OCOC(=O)COCc1ccccc1)OC(C)(C)C |
| InChI | InChI=1S/C18H29O7P/c1-17(2,3)24-26(20,25-18(4,5)6)23-14-22-16(19)13-21-12-15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3 |
| InChIKey | LUESZTONGXECOG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|