C29H47N2O11P — CID 168825827
benzyl (3S)-3-[[bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]morpholine-4-carboxylate (PubChem CID 168825827) has the molecular formula C29H47N2O11P and a molecular weight of 630.67 g/mol. Its IUPAC name is benzyl (3S)-3-[[bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]morpholine-4-carboxylate.
| Compound Name | benzyl (3S)-3-[[bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 168825827 |
| Molecular Formula | C29H47N2O11P |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | benzyl (3S)-3-[[bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)CN(C[C@H]1COCCN1C(=O)OCc1ccccc1)C(=O)OCOP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C29H47N2O11P/c1-27(2,3)40-24(32)18-30(25(33)38-21-39-43(35,41-28(4,5)6)42-29(7,8)9)17-23-20-36-16-15-31(23)26(34)37-19-22-13-11-10-12-14-22/h10-14,23H,15-21H2,1-9H3/t23-/m0/s1 |
| InChIKey | YYUGAYITONEQRK-QHCPKHFHSA-N |
| XLogP | 5.52 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|