C23H33O3P — CID 173485287
[phenylmethoxy(2,2,4,4-tetramethylpentan-3-yl)phosphoryl]oxymethylbenzene (PubChem CID 173485287) has the molecular formula C23H33O3P and a molecular weight of 388.49 g/mol. Its IUPAC name is [phenylmethoxy(2,2,4,4-tetramethylpentan-3-yl)phosphoryl]oxymethylbenzene.
| Compound Name | [phenylmethoxy(2,2,4,4-tetramethylpentan-3-yl)phosphoryl]oxymethylbenzene |
|---|---|
| PubChem CID | 173485287 |
| Molecular Formula | C23H33O3P |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [phenylmethoxy(2,2,4,4-tetramethylpentan-3-yl)phosphoryl]oxymethylbenzene |
| SMILES | CC(C)(C)C(C(C)(C)C)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H33O3P/c1-22(2,3)21(23(4,5)6)27(24,25-17-19-13-9-7-10-14-19)26-18-20-15-11-8-12-16-20/h7-16,21H,17-18H2,1-6H3 |
| InChIKey | BXKFRUTUYZSBFN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|