C23H34NO4P — CID 22041931
N-[1-bis(phenylmethoxy)phosphoryl-2,2-dimethylpropyl]-N-tert-butylhydroxylamine (PubChem CID 22041931) has the molecular formula C23H34NO4P and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[1-bis(phenylmethoxy)phosphoryl-2,2-dimethylpropyl]-N-tert-butylhydroxylamine.
| Compound Name | N-[1-bis(phenylmethoxy)phosphoryl-2,2-dimethylpropyl]-N-tert-butylhydroxylamine |
|---|---|
| PubChem CID | 22041931 |
| Molecular Formula | C23H34NO4P |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[1-bis(phenylmethoxy)phosphoryl-2,2-dimethylpropyl]-N-tert-butylhydroxylamine |
| SMILES | CC(C)(C)C(N(O)C(C)(C)C)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H34NO4P/c1-22(2,3)21(24(25)23(4,5)6)29(26,27-17-19-13-9-7-10-14-19)28-18-20-15-11-8-12-16-20/h7-16,21,25H,17-18H2,1-6H3 |
| InChIKey | JCELFOINQKQYAL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|