C23H26NO4P — CID 102186412
bis(phenylmethoxy)phosphoryl-[4-(dimethylamino)phenyl]methanol (PubChem CID 102186412) has the molecular formula C23H26NO4P and a molecular weight of 411.44 g/mol. Its IUPAC name is bis(phenylmethoxy)phosphoryl-[4-(dimethylamino)phenyl]methanol.
| Compound Name | bis(phenylmethoxy)phosphoryl-[4-(dimethylamino)phenyl]methanol |
|---|---|
| PubChem CID | 102186412 |
| Molecular Formula | C23H26NO4P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | bis(phenylmethoxy)phosphoryl-[4-(dimethylamino)phenyl]methanol |
| SMILES | CN(C)c1ccc(C(O)P(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26NO4P/c1-24(2)22-15-13-21(14-16-22)23(25)29(26,27-17-19-9-5-3-6-10-19)28-18-20-11-7-4-8-12-20/h3-16,23,25H,17-18H2,1-2H3 |
| InChIKey | RLBJJEJIWAOZEN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|