C22H23BrNO3P — CID 11862751
(S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]methanol (PubChem CID 11862751) has the molecular formula C22H23BrNO3P and a molecular weight of 460.31 g/mol. Its IUPAC name is (S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]methanol.
| Compound Name | (S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]methanol |
|---|---|
| PubChem CID | 11862751 |
| Molecular Formula | C22H23BrNO3P |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]methanol |
| SMILES | CN(C)c1ccc([P@](=O)(OCc2ccccc2)[C@H](O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H23BrNO3P/c1-24(2)20-12-14-21(15-13-20)28(26,27-16-17-6-4-3-5-7-17)22(25)18-8-10-19(23)11-9-18/h3-15,22,25H,16H2,1-2H3/t22-,28-/m0/s1 |
| InChIKey | JFZBKYNNMBBHPI-DWACAAAGSA-N |
| XLogP | 5.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|