C23H26NO4P — CID 11863286
(S)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-(4-methoxyphenyl)methanol (PubChem CID 11863286) has the molecular formula C23H26NO4P and a molecular weight of 411.44 g/mol. Its IUPAC name is (S)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-(4-methoxyphenyl)methanol.
| Compound Name | (S)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 11863286 |
| Molecular Formula | C23H26NO4P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (S)-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc([C@@H](O)[P@](=O)(OCc2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H26NO4P/c1-24(2)20-11-15-22(16-12-20)29(26,28-17-18-7-5-4-6-8-18)23(25)19-9-13-21(27-3)14-10-19/h4-16,23,25H,17H2,1-3H3/t23-,29+/m0/s1 |
| InChIKey | ZBCHVPFBTSZELS-MUAVYFROSA-N |
| XLogP | 4.57 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|