C19H25ClNO3P — CID 11862972
(R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(4-chlorophenyl)methanol (PubChem CID 11862972) has the molecular formula C19H25ClNO3P and a molecular weight of 381.84 g/mol. Its IUPAC name is (R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(4-chlorophenyl)methanol.
| Compound Name | (R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 11862972 |
| Molecular Formula | C19H25ClNO3P |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(4-chlorophenyl)methanol |
| SMILES | CCCCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClNO3P/c1-4-5-14-24-25(23,18-12-10-17(11-13-18)21(2)3)19(22)15-6-8-16(20)9-7-15/h6-13,19,22H,4-5,14H2,1-3H3/t19-,25+/m1/s1 |
| InChIKey | WVIKTHFAJJUBSS-CLOONOSVSA-N |
| XLogP | 4.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|