C19H24Cl2NO3P — CID 3287496
[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(2,6-dichlorophenyl)methanol (PubChem CID 3287496) has the molecular formula C19H24Cl2NO3P and a molecular weight of 416.29 g/mol. Its IUPAC name is [butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(2,6-dichlorophenyl)methanol.
| Compound Name | [butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(2,6-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 3287496 |
| Molecular Formula | C19H24Cl2NO3P |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(2,6-dichlorophenyl)methanol |
| SMILES | CCCCOP(=O)(c1ccc(N(C)C)cc1)C(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H24Cl2NO3P/c1-4-5-13-25-26(24,15-11-9-14(10-12-15)22(2)3)19(23)18-16(20)7-6-8-17(18)21/h6-12,19,23H,4-5,13H2,1-3H3 |
| InChIKey | PRUWMCDBKSNGLJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|