C21H30NO5P — CID 11862953
(R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4-dimethoxyphenyl)methanol (PubChem CID 11862953) has the molecular formula C21H30NO5P and a molecular weight of 407.45 g/mol. Its IUPAC name is (R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4-dimethoxyphenyl)methanol.
| Compound Name | (R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 11862953 |
| Molecular Formula | C21H30NO5P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (R)-[butoxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4-dimethoxyphenyl)methanol |
| SMILES | CCCCO[P@](=O)(c1ccc(N(C)C)cc1)[C@@H](O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H30NO5P/c1-6-7-14-27-28(24,18-11-9-17(10-12-18)22(2)3)21(23)16-8-13-19(25-4)20(15-16)26-5/h8-13,15,21,23H,6-7,14H2,1-5H3/t21-,28-/m1/s1 |
| InChIKey | VQCYFCVGTCBMOH-LYZGTLIUSA-N |
| XLogP | 4.18 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|