C22H32NO5P — CID 11863150
(S)-(2,5-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]methanol (PubChem CID 11863150) has the molecular formula C22H32NO5P and a molecular weight of 421.47 g/mol. Its IUPAC name is (S)-(2,5-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]methanol.
| Compound Name | (S)-(2,5-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]methanol |
|---|---|
| PubChem CID | 11863150 |
| Molecular Formula | C22H32NO5P |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (S)-(2,5-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]methanol |
| SMILES | COc1ccc(OC)c([C@@H](O)[P@](=O)(OCCC(C)C)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C22H32NO5P/c1-16(2)13-14-28-29(25,19-10-7-17(8-11-19)23(3)4)22(24)20-15-18(26-5)9-12-21(20)27-6/h7-12,15-16,22,24H,13-14H2,1-6H3/t22-,29+/m0/s1 |
| InChIKey | FOQWBHDXJHFCGR-PZGXJGMVSA-N |
| XLogP | 4.43 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|