C26H33N2O4P — CID 41081085
4-[[(R)-anilino-(2,5-dimethoxyphenyl)methyl]-propoxyphosphoryl]-N,N-dimethylaniline (PubChem CID 41081085) has the molecular formula C26H33N2O4P and a molecular weight of 468.53 g/mol. Its IUPAC name is 4-[[(R)-anilino-(2,5-dimethoxyphenyl)methyl]-propoxyphosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[(R)-anilino-(2,5-dimethoxyphenyl)methyl]-propoxyphosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 41081085 |
| Molecular Formula | C26H33N2O4P |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 4-[[(R)-anilino-(2,5-dimethoxyphenyl)methyl]-propoxyphosphoryl]-N,N-dimethylaniline |
| SMILES | CCCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](Nc1ccccc1)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C26H33N2O4P/c1-6-18-32-33(29,23-15-12-21(13-16-23)28(2)3)26(27-20-10-8-7-9-11-20)24-19-22(30-4)14-17-25(24)31-5/h7-17,19,26-27H,6,18H2,1-5H3/t26-,33+/m1/s1 |
| InChIKey | PIJMHVMWQRDCQS-NYFMKLKXSA-N |
| XLogP | 5.91 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|