C24H30N3O2P — CID 11863272
4-[(R)-anilino-[[4-(dimethylamino)phenyl]-methoxyphosphoryl]methyl]-N,N-dimethylaniline (PubChem CID 11863272) has the molecular formula C24H30N3O2P and a molecular weight of 423.50 g/mol. Its IUPAC name is 4-[(R)-anilino-[[4-(dimethylamino)phenyl]-methoxyphosphoryl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(R)-anilino-[[4-(dimethylamino)phenyl]-methoxyphosphoryl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11863272 |
| Molecular Formula | C24H30N3O2P |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[(R)-anilino-[[4-(dimethylamino)phenyl]-methoxyphosphoryl]methyl]-N,N-dimethylaniline |
| SMILES | CO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](Nc1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H30N3O2P/c1-26(2)21-13-11-19(12-14-21)24(25-20-9-7-6-8-10-20)30(28,29-5)23-17-15-22(16-18-23)27(3)4/h6-18,24-25H,1-5H3/t24-,30+/m1/s1 |
| InChIKey | DPBIYMDFWFIHFR-HLADLETHSA-N |
| XLogP | 5.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|