C23H28N3O2P — CID 11863119
4-[[(R)-anilino(pyridin-3-yl)methyl]-propan-2-yloxyphosphoryl]-N,N-dimethylaniline (PubChem CID 11863119) has the molecular formula C23H28N3O2P and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-[[(R)-anilino(pyridin-3-yl)methyl]-propan-2-yloxyphosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[(R)-anilino(pyridin-3-yl)methyl]-propan-2-yloxyphosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11863119 |
| Molecular Formula | C23H28N3O2P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[[(R)-anilino(pyridin-3-yl)methyl]-propan-2-yloxyphosphoryl]-N,N-dimethylaniline |
| SMILES | CC(C)O[P@](=O)(c1ccc(N(C)C)cc1)[C@@H](Nc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C23H28N3O2P/c1-18(2)28-29(27,22-14-12-21(13-15-22)26(3)4)23(19-9-8-16-24-17-19)25-20-10-6-5-7-11-20/h5-18,23,25H,1-4H3/t23-,29-/m1/s1 |
| InChIKey | OHFRJZYCAMAOTN-RNWIMVQKSA-N |
| XLogP | 5.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|