C25H31N2O2P — CID 11862710
4-[[(R)-anilino(phenyl)methyl]-(2-methylpropoxy)phosphoryl]-N,N-dimethylaniline (PubChem CID 11862710) has the molecular formula C25H31N2O2P and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-[[(R)-anilino(phenyl)methyl]-(2-methylpropoxy)phosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[(R)-anilino(phenyl)methyl]-(2-methylpropoxy)phosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11862710 |
| Molecular Formula | C25H31N2O2P |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-[[(R)-anilino(phenyl)methyl]-(2-methylpropoxy)phosphoryl]-N,N-dimethylaniline |
| SMILES | CC(C)CO[P@](=O)(c1ccc(N(C)C)cc1)[C@@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N2O2P/c1-20(2)19-29-30(28,24-17-15-23(16-18-24)27(3)4)25(21-11-7-5-8-12-21)26-22-13-9-6-10-14-22/h5-18,20,25-26H,19H2,1-4H3/t25-,30-/m1/s1 |
| InChIKey | OGCXNCGINLAPHU-FYBSXPHGSA-N |
| XLogP | 6.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|