C26H33N2O2P — CID 3266264
4-[[anilino(phenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline (PubChem CID 3266264) has the molecular formula C26H33N2O2P and a molecular weight of 436.54 g/mol. Its IUPAC name is 4-[[anilino(phenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[anilino(phenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3266264 |
| Molecular Formula | C26H33N2O2P |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[[anilino(phenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline |
| SMILES | CC(C)CCOP(=O)(c1ccc(N(C)C)cc1)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33N2O2P/c1-21(2)19-20-30-31(29,25-17-15-24(16-18-25)28(3)4)26(22-11-7-5-8-12-22)27-23-13-9-6-10-14-23/h5-18,21,26-27H,19-20H2,1-4H3 |
| InChIKey | UZTPWQHVXIBFQF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|