C20H28NO3P — CID 11879084
(R)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-phenylmethanol (PubChem CID 11879084) has the molecular formula C20H28NO3P and a molecular weight of 361.42 g/mol. Its IUPAC name is (R)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-phenylmethanol.
| Compound Name | (R)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-phenylmethanol |
|---|---|
| PubChem CID | 11879084 |
| Molecular Formula | C20H28NO3P |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (R)-[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-phenylmethanol |
| SMILES | CC(C)CCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H28NO3P/c1-16(2)14-15-24-25(23,20(22)17-8-6-5-7-9-17)19-12-10-18(11-13-19)21(3)4/h5-13,16,20,22H,14-15H2,1-4H3/t20-,25+/m1/s1 |
| InChIKey | NDSMUUMNRYBCPP-NLFFAJNJSA-N |
| XLogP | 4.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|