C18H25N2O3P — CID 11860785
(R)-[[4-(dimethylamino)phenyl]-(2-methylpropoxy)phosphoryl]-pyridin-4-ylmethanol (PubChem CID 11860785) has the molecular formula C18H25N2O3P and a molecular weight of 348.38 g/mol. Its IUPAC name is (R)-[[4-(dimethylamino)phenyl]-(2-methylpropoxy)phosphoryl]-pyridin-4-ylmethanol.
| Compound Name | (R)-[[4-(dimethylamino)phenyl]-(2-methylpropoxy)phosphoryl]-pyridin-4-ylmethanol |
|---|---|
| PubChem CID | 11860785 |
| Molecular Formula | C18H25N2O3P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (R)-[[4-(dimethylamino)phenyl]-(2-methylpropoxy)phosphoryl]-pyridin-4-ylmethanol |
| SMILES | CC(C)CO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](O)c1ccncc1 |
| InChI | InChI=1S/C18H25N2O3P/c1-14(2)13-23-24(22,18(21)15-9-11-19-12-10-15)17-7-5-16(6-8-17)20(3)4/h5-12,14,18,21H,13H2,1-4H3/t18-,24+/m1/s1 |
| InChIKey | WWNLPOUMVHJLMA-KOSHJBKYSA-N |
| XLogP | 3.41 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|