C18H24NO3P — CID 11863122
(R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-phenylmethanol (PubChem CID 11863122) has the molecular formula C18H24NO3P and a molecular weight of 333.37 g/mol. Its IUPAC name is (R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-phenylmethanol.
| Compound Name | (R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-phenylmethanol |
|---|---|
| PubChem CID | 11863122 |
| Molecular Formula | C18H24NO3P |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-phenylmethanol |
| SMILES | CCCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H24NO3P/c1-4-14-22-23(21,18(20)15-8-6-5-7-9-15)17-12-10-16(11-13-17)19(2)3/h5-13,18,20H,4,14H2,1-3H3/t18-,23+/m1/s1 |
| InChIKey | AVOAUULDRYUJOO-JPYJTQIMSA-N |
| XLogP | 3.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|