C21H30NO6P — CID 11876273
(R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 11876273) has the molecular formula C21H30NO6P and a molecular weight of 423.45 g/mol. Its IUPAC name is (R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | (R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 11876273 |
| Molecular Formula | C21H30NO6P |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (R)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | CCCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H30NO6P/c1-7-12-28-29(24,17-10-8-16(9-11-17)22(2)3)21(23)15-13-18(25-4)20(27-6)19(14-15)26-5/h8-11,13-14,21,23H,7,12H2,1-6H3/t21-,29+/m1/s1 |
| InChIKey | ICXKINBIPDENML-PBBNMVCDSA-N |
| XLogP | 3.80 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|