C24H34NO6P — CID 11863321
(R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 11863321) has the molecular formula C24H34NO6P and a molecular weight of 463.51 g/mol. Its IUPAC name is (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 11863321 |
| Molecular Formula | C24H34NO6P |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc([C@H](O)[P@@](=O)(OC2CCCCC2)c2ccc(N(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H34NO6P/c1-25(2)18-11-13-20(14-12-18)32(27,31-19-9-7-6-8-10-19)24(26)17-15-21(28-3)23(30-5)22(16-17)29-4/h11-16,19,24,26H,6-10H2,1-5H3/t24-,32+/m1/s1 |
| InChIKey | QEMLGICHKQXJJL-QNLPTKCRSA-N |
| XLogP | 4.72 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|