C21H28NO3P — CID 11863067
(R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-phenylmethanol (PubChem CID 11863067) has the molecular formula C21H28NO3P and a molecular weight of 373.43 g/mol. Its IUPAC name is (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-phenylmethanol.
| Compound Name | (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-phenylmethanol |
|---|---|
| PubChem CID | 11863067 |
| Molecular Formula | C21H28NO3P |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-phenylmethanol |
| SMILES | CN(C)c1ccc([P@@](=O)(OC2CCCCC2)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28NO3P/c1-22(2)18-13-15-20(16-14-18)26(24,25-19-11-7-4-8-12-19)21(23)17-9-5-3-6-10-17/h3,5-6,9-10,13-16,19,21,23H,4,7-8,11-12H2,1-2H3/t21-,26-/m1/s1 |
| InChIKey | YAAYRNWARXLNIC-QFQXNSOFSA-N |
| XLogP | 4.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|