C21H30NO3P — CID 11906970
(S)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]-(4-propan-2-ylphenyl)methanol (PubChem CID 11906970) has the molecular formula C21H30NO3P and a molecular weight of 375.45 g/mol. Its IUPAC name is (S)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]-(4-propan-2-ylphenyl)methanol.
| Compound Name | (S)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]-(4-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 11906970 |
| Molecular Formula | C21H30NO3P |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (S)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]-(4-propan-2-ylphenyl)methanol |
| SMILES | CC(C)O[P@@](=O)(c1ccc(N(C)C)cc1)[C@H](O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H30NO3P/c1-15(2)17-7-9-18(10-8-17)21(23)26(24,25-16(3)4)20-13-11-19(12-14-20)22(5)6/h7-16,21,23H,1-6H3/t21-,26-/m0/s1 |
| InChIKey | UMBFGWSVXWGLKB-LVXARBLLSA-N |
| XLogP | 4.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|