C20H28NO5P — CID 11863029
(R)-(2,4-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]methanol (PubChem CID 11863029) has the molecular formula C20H28NO5P and a molecular weight of 393.42 g/mol. Its IUPAC name is (R)-(2,4-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]methanol.
| Compound Name | (R)-(2,4-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]methanol |
|---|---|
| PubChem CID | 11863029 |
| Molecular Formula | C20H28NO5P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (R)-(2,4-dimethoxyphenyl)-[[4-(dimethylamino)phenyl]-propan-2-yloxyphosphoryl]methanol |
| SMILES | COc1ccc([C@H](O)[P@](=O)(OC(C)C)c2ccc(N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H28NO5P/c1-14(2)26-27(23,17-10-7-15(8-11-17)21(3)4)20(22)18-12-9-16(24-5)13-19(18)25-6/h7-14,20,22H,1-6H3/t20-,27-/m1/s1 |
| InChIKey | HVUKZBBMUHJLSL-NFQMXDRXSA-N |
| XLogP | 3.79 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|