C22H30NO4P — CID 11863033
(R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(2-methoxyphenyl)methanol (PubChem CID 11863033) has the molecular formula C22H30NO4P and a molecular weight of 403.46 g/mol. Its IUPAC name is (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(2-methoxyphenyl)methanol.
| Compound Name | (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(2-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 11863033 |
| Molecular Formula | C22H30NO4P |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (R)-[cyclohexyloxy-[4-(dimethylamino)phenyl]phosphoryl]-(2-methoxyphenyl)methanol |
| SMILES | COc1ccccc1[C@H](O)[P@@](=O)(OC1CCCCC1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H30NO4P/c1-23(2)17-13-15-19(16-14-17)28(25,27-18-9-5-4-6-10-18)22(24)20-11-7-8-12-21(20)26-3/h7-8,11-16,18,22,24H,4-6,9-10H2,1-3H3/t22-,28+/m1/s1 |
| InChIKey | DQRJBSVBSJPXDF-DFHRPNOPSA-N |
| XLogP | 4.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|