C28H37N2O4P — CID 3631354
4-[[anilino-(2,4-dimethoxyphenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline (PubChem CID 3631354) has the molecular formula C28H37N2O4P and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[[anilino-(2,4-dimethoxyphenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[anilino-(2,4-dimethoxyphenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3631354 |
| Molecular Formula | C28H37N2O4P |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-[[anilino-(2,4-dimethoxyphenyl)methyl]-(3-methylbutoxy)phosphoryl]-N,N-dimethylaniline |
| SMILES | COc1ccc(C(Nc2ccccc2)P(=O)(OCCC(C)C)c2ccc(N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C28H37N2O4P/c1-21(2)18-19-34-35(31,25-15-12-23(13-16-25)30(3)4)28(29-22-10-8-7-9-11-22)26-17-14-24(32-5)20-27(26)33-6/h7-17,20-21,28-29H,18-19H2,1-6H3 |
| InChIKey | BGJYVJSXHBRLGZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|