C22H32NO6P — CID 21210947
N-[(2,4-dimethoxyphenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-methoxyaniline (PubChem CID 21210947) has the molecular formula C22H32NO6P and a molecular weight of 437.47 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-methoxyaniline.
| Compound Name | N-[(2,4-dimethoxyphenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 21210947 |
| Molecular Formula | C22H32NO6P |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-methoxyaniline |
| SMILES | COc1ccc(NC(c2ccc(OC)cc2OC)P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C22H32NO6P/c1-15(2)28-30(24,29-16(3)4)22(23-17-8-10-18(25-5)11-9-17)20-13-12-19(26-6)14-21(20)27-7/h8-16,22-23H,1-7H3 |
| InChIKey | ZEJMZZJKTVOHRR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|