C20H27INO5P — CID 21210923
N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-4-iodo-2-methylaniline (PubChem CID 21210923) has the molecular formula C20H27INO5P and a molecular weight of 519.32 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-4-iodo-2-methylaniline.
| Compound Name | N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 21210923 |
| Molecular Formula | C20H27INO5P |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-4-iodo-2-methylaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(I)cc1C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C20H27INO5P/c1-6-26-28(23,27-7-2)20(22-18-11-8-15(21)12-14(18)3)17-10-9-16(24-4)13-19(17)25-5/h8-13,20,22H,6-7H2,1-5H3 |
| InChIKey | SSJODFVFEFXQQZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|