C18H23ClNO4P — CID 21210989
3-chloro-N-[diethoxyphosphoryl-(2-methoxyphenyl)methyl]aniline (PubChem CID 21210989) has the molecular formula C18H23ClNO4P and a molecular weight of 383.81 g/mol. Its IUPAC name is 3-chloro-N-[diethoxyphosphoryl-(2-methoxyphenyl)methyl]aniline.
| Compound Name | 3-chloro-N-[diethoxyphosphoryl-(2-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 21210989 |
| Molecular Formula | C18H23ClNO4P |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-chloro-N-[diethoxyphosphoryl-(2-methoxyphenyl)methyl]aniline |
| SMILES | CCOP(=O)(OCC)C(Nc1cccc(Cl)c1)c1ccccc1OC |
| InChI | InChI=1S/C18H23ClNO4P/c1-4-23-25(21,24-5-2)18(16-11-6-7-12-17(16)22-3)20-15-10-8-9-14(19)13-15/h6-13,18,20H,4-5H2,1-3H3 |
| InChIKey | CRNUXWDRXSLGEE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|